Diethyl (3-fluoro-4-nitrophenyl)methylmalonate is a chemical compound bearing a methylmalonate diester framework substituted with a fluorinated nitroaryl group. It is primarily used as a synthetic intermediate in the preparation of various pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 78543-06-3
Diethyl (4-amino-3-fluorophenyl)methylmalonate
pharmaceutical intermediate
3-(TRIFLUOROMETHYL)BENZENEPROPANOL
Pharmaceutical intermediate
(S)-(-)-2-Amino-3-methyl-1,1-diphenyl-1-butanol
Chiral pharmaceutical intermediate
2-chloro-3-iodopyridine
pharmaceutical intermediate
diethyl 2-(3-fluoro-4-nitrophenyl)-2-methylpropanedioate
VHMVOAWAZZEEPH-UHFFFAOYSA-N
CCOC(=O)C(C)(C1=CC(=C(C=C1)[N+](=O)[O-])F)C(=O)OCC