(2S)-2-phenylpropanoic acid is a chiral carboxylic acid used primarily in co-crystallization studies. Its significance lies in its ability to form co-crystals with isonicotinamide, influencing melting-point behavior as investigated in crystallographic research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 7782-24-3
Iodic acid
Astringent and disinfectant
SELENIOUS ACID
Reagent for alkaloids and oxidizing agent
Molybdenum hexafluoride
Isotope separation reagent
(S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine
Research compound
(2R)-2-phenylpropanoic acid
chiral building block for pharmaceuticals
2-Phenylpropionic acid
Human xenobiotic metabolite research
(2S)-2-phenylpropanoic acid
YPGCWEMNNLXISK-ZETCQYMHSA-N
C[C@@H](C1=CC=CC=C1)C(=O)O