6-Carboxycoumarin is a chemical compound featuring a coumarin core with a carboxylic acid substituent. It is primarily used as a pharmaceutical intermediate.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
6-Carboxycoumarin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Mono-4-nitrobenzyl Malonate
Pharmaceutical intermediate
Boc-Ser-Otbu
amino acid protecting group intermediate
6-Chloro-4-(o-chlorophenyl)-2-quinazoline methanol
Pharmaceutical impurity standard
3-Bromo-4-methylaniline
pharmaceutical intermediate
6-Methylcoumarin
Flavor and fragrance ingredient
4-Hydroxycoumarin
Chemical research reagent
Ac-DEVD-AMC
caspase substrate for apoptosis assays
7-Methoxycoumarin-3-carboxylic acid
research compound for crystallography studies
6-Carboxycoumarin(CAS 7734-80-7)의 국제 HS 코드는 2932.20입니다.
2932.20
2932 20 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2-oxochromene-6-carboxylic acid
GEFDYGOYVXEKBE-UHFFFAOYSA-N
C1=CC2=C(C=CC(=O)O2)C=C1C(=O)O
6-Carboxycoumarin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.