2-HYDROXY-5-NITROBENZYL BROMIDE is a chemical compound commonly used as a laboratory reagent. Its primary significance is in research applications for the chemical modification of tryptophan residues in proteins.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 772-33-8
(1,1-2H2)-2,2,2-Trifluoroetane-1-(2H)ol
Deuterated NMR reference standard
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
3-Amino-3-(1-methyl-1H-pyrrol-2-yl)propanoic acid
research compound for peptide synthesis
1,3-Benzodioxole-5-carboxylic acid, 2,2-difluoro-, methyl ester
research compound
2-(bromomethyl)-4-nitrophenol
KFDPCYZHENQOBV-UHFFFAOYSA-N
C1=CC(=C(C=C1[N+](=O)[O-])CBr)O