4-Bromobenzonitrile-d4 is a deuterated research reagent, specifically the isotopically labeled form of 4-bromobenzonitrile where all four aromatic hydrogen atoms are replaced with deuterium. This compound is used in analytical and research applications that require stable isotope labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Bromobenzonitrile-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Chloro-1,2-benzisothiazole
research compound
4-(4-pyridyl)-3H-thiazole-2-thione
research compound
5,6-Dihydroxypyrazine-2-carboxylic acid
research compound
Flaconitine
Reference standard
4-BROMOBENZONITRILE
organic synthesis intermediate
4-bromo-2,3,5,6-tetradeuteriobenzonitrile
HQSCPPCMBMFJJN-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C#N)[2H])[2H])Br)[2H]
4-Bromobenzonitrile-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.