(2-Benzylacryloyl)glycine is a chemical compound used as a reference standard in the manufacture and quality control of the pharmaceutical intermediate alvimopan. It is characterized by an aromatic ring, an amide group, and a carboxylic acid group, giving it moderate polarity and a single aromatic ring structure.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 76932-18-8
4-Chloro-3-methylbenzoic acid
Pharmaceutical intermediate
Phenyl(1H-pyrrol-2-yl)methanone
Pharmaceutical intermediate for drug synthesis
Deuterium chloride
Deuterated reagent for synthesis
D-3-(2-naphthyl)alanine
pharmaceutical intermediate
2-(2-benzylprop-2-enoylamino)acetic acid
FSCZNKNUJVBMPY-UHFFFAOYSA-N
C=C(CC1=CC=CC=C1)C(=O)NCC(=O)O