N-Benzylglycine hydrochloride is a research compound used in peptide synthesis. It is the hydrochloride salt form of N-benzylglycine, featuring both an amine and a carboxylic acid group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 7689-50-1
3-Amino-3-(1-methyl-1H-pyrrol-2-yl)propanoic acid
research compound for peptide synthesis
(R)-alpha-Propargylalanine
research compound for peptide synthesis
4-(Diethylamino)benzoic acid
research compound for peptide synthesis
Methyl 1-amino-1-cyclopentanecarboxylate, HCl
research compound for peptide synthesis
2-Fluoro-6-nitrotoluene
research compound
3-Cyano-4,6-dimethyl-2-hydroxypyridine
research compound
2,3,5,6-Tetrafluorophenol
research compound
Vinyl benzoate
human metabolite research compound
2-(benzylamino)acetic acid;hydrochloride
BUZJPENZWLUHJD-UHFFFAOYSA-N
C1=CC=C(C=C1)CNCC(=O)O.Cl