Carboxymethyl acemetacin is a chemical compound used as a pharmaceutical intermediate in the synthesis of acemetacin analogs. It features a complex structure containing indole, ester, ether, and carboxylic acid functional groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Carboxymethyl acemetacin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Acemetacin
non-steroidal anti-inflammatory drug
(tert-Butoxycarbonyl)methyl 2-(1-((4-chlorophenyl)carbonyl)-5-methoxy-2-methylindol-3-yl)acetate
Pharmaceutical intermediate for acemetacin derivatives
2-[2-[1-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyacetic acid
deuterated pharmaceutical reference standard
인도메타신
active pharmaceutical ingredient
(S)-2-Aminobutyramide hydrochloride
peptide synthesis building block
N1,N3-Bis(2,3-dihydroxypropyl)-5-nitro-1,3-benzenedicarboxamide
Iohexol related compound C
5-METHOXY-2-PHENOXYANILINE
Pharmaceutical intermediate
Azetidon
Beta-lactam antibiotic intermediate
2-[2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxyacetyl]oxyacetic acid
GTRKDHSTYCPSAB-UHFFFAOYSA-N
CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OCC(=O)OCC(=O)O
Carboxymethyl acemetacin 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.