2,6-Di-tert-butyl-4-heptylphenol is a sterically hindered phenol compound used primarily as an industrial antioxidant intermediate. Its structure features a phenol ring with bulky tert-butyl groups and a heptyl side chain, contributing to its role in stabilizing materials against oxidative degradation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 765956-84-1
2,6-ditert-butyl-4-heptylphenol
OEHMRECZRLQSRD-UHFFFAOYSA-N
CCCCCCCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C