(R)-(+)-Cathinone hydrochloride is a research reagent and the hydrochloride salt of the optically active (R)-enantiomer of cathinone, a naturally occurring alkaloid. It is primarily used in scientific research and analytical reference applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 76333-53-4
Methyl 2,2-dimethylpent-4-enoate
research compound
Antimony(V) chloride
Lewis acid catalyst and reagent
2-(Trimethylsilyl)ethoxymethyl chloride
Protecting reagent for hydroxyl groups
2-(mesitylamino)-9,10-dimethoxy-6,7-dihydro-4H-pyrimido[6,1-a]isoquinolin-4-one
research compound
2-amino-1-phenylpropan-1-one;hydrochloride
pharmaceutical reference standard
Cathinone hydrochloride
active pharmaceutical ingredient
(2R)-2-amino-1-phenylpropan-1-one;hydrochloride
HPZCAKYHISJOIK-OGFXRTJISA-N
C[C@H](C(=O)C1=CC=CC=C1)N.Cl