Diethyl 2,3-difluorofumarate is a fluorinated organic compound used as a building block in chemical synthesis. It features two ester groups and two fluorine atoms on a carbon backbone, making it valuable for introducing fluorine into target molecules in research and industrial chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 7589-41-5
4-(Ethoxycarbonyl)-4,4-difluorobutanoic acid
fluorinated building block for synthesis
(2Z)-2,3-Difluoro-2-butenedioic acid
fluorinated building block for synthesis
Ethyl 2-fluoro-3-oxopentanoate
research compound
1-Ethyl-1-nitrosourea
experimental mutagen and ethylating agent
2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Vinyl boronate synthetic reagent
Phthalic Acid Anhydride-d4
Reference standard for analytical chemistry
Diethyl 2,3-difluoromaleate
research compound
diethyl (E)-2,3-difluorobut-2-enedioate
PBYMHUNMKVHXHO-AATRIKPKSA-N
CCOC(=O)/C(=C(/C(=O)OCC)\F)/F