Sudan I-d5 is a deuterated analytical reference standard, specifically a pentadeuterio-labeled derivative of Sudan I. It is primarily used as an internal standard in analytical chemistry for the quantification of Sudan I in various samples.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Sudan I-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Ethynyl-N,N-dimethylaniline
research compound
Methyl L-phenylalaninate hydrochloride
Research reagent for peptide synthesis
Sodium 2-(4-(2-hydroxyethyl)piperazin-1-yl)ethanesulfonate
dipolar ionic buffer
H-alpha-Me-D-Phe(4-Br)-OH
research compound
C.I. Solvent Yellow 14
Dye for hydrocarbon solvents and oils
1-(2-METHOXY-D3-PHENYLAZO)-2-NAPHTHOL
Azo dye for coloration
Crocein Orange G
synthetic azo dye for coloring
E129
food color additive
1-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]naphthalen-2-ol
MRQIXHXHHPWVIL-RCQSQLKUSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N=NC2=C(C=CC3=CC=CC=C32)O)[2H])[2H]
Sudan I-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.