N-Nitro tetradehydroargatroban is a chemical compound that serves as an intermediate in the synthesis of pharmaceutical agents. It features a complex structure with multiple ring systems and functional groups, including an amide and carboxylic acid, commonly associated with small-molecule drug manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-Nitro tetradehydroargatroban 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ethyl (2R,4R)-1-[(2S)-5-[[imino(nitroamino)methyl]amino]-2-[[(3-methyl-8-quinolinyl)sulfonyl]amino]-1-oxopentyl]-4-methyl-2-piperidinecarboxylate
Pharmaceutical intermediate for argatroban analog
Benzoic acid, 4-(acetylamino)-3-bromo-2-(2-bromoethoxy)-5-chloro-, methyl ester
pharmaceutical intermediate
(S)-(+)-2-Methylpiperazine
pharmaceutical intermediate
(2R,4R)-4-methylpiperidine-2-carboxylic acid
Chiral building block for synthesis
Ethyl (2R,4R)-4-methyl-2-piperidinecarboxylate
Pharmaceutical intermediate
(2R,4R)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(3-methylquinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid
XBDLKMBSCAVLDV-FHLIZLRMSA-N
C[C@@H]1CCN([C@H](C1)C(=O)O)C(=O)[C@H](CCCN=C(N)N[N+](=O)[O-])NS(=O)(=O)C2=CC=CC3=C2N=CC(=C3)C
N-Nitro tetradehydroargatroban 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.