Quinoline-2-boronic acid is a boronic acid derivative of quinoline used primarily as a research reagent. Its structure features an aromatic heterocyclic ring system with a boronic acid functional group, making it a versatile building block in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 745784-12-7
Ethyl cyclopropylideneacetate
research compound
Diethylene Glycol Bis(p-toluenesulfonate)
research compound for crystallography
1-(2-azidoethoxy)-2-(2-methoxyethoxy)ethane
PEG linker with azide group
(S)-4-AMINO-3-(4-FLUOROPHENYL)BUTANOIC ACID
Research compound
quinolin-2-ylboronic acid
DWHCQRBWSBKHMI-UHFFFAOYSA-N
B(C1=NC2=CC=CC=C2C=C1)(O)O