Benzyl tert-butyl malonate is a chemical compound primarily used as a pharmaceutical intermediate. It features two ester functional groups and an aromatic ring, serving as a building block in organic synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 72594-86-6
Dibenzyl malonate
Chemical intermediate for synthesis
2-Chloro-3-fluoro-5-(trifluoromethyl)pyridine
Pharmaceutical intermediate
5-oxopyrrolidine-3-carboxylic acid
pharmaceutical intermediate
D-Lysine monohydrochloride
Pharmaceutical intermediate and research reagent
2-HYDROXYPYRIDINE
pharmaceutical intermediate
1-O-benzyl 3-O-tert-butyl propanedioate
XKXXXODAXXAFNP-UHFFFAOYSA-N
CC(C)(C)OC(=O)CC(=O)OCC1=CC=CC=C1