This compound is a brominated aromatic ether compound used as a pharmaceutical intermediate. Its structure features a dihydronaphthalene core with a bromine substituent and a benzyl ether group, making it suitable for further synthetic transformations in drug development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 722536-73-4
Emtmpc
Pharmaceutical intermediate synthesis
(2S,4S)-(+)-2,4-Pentanediol
pharmaceutical intermediate
(5S)-5-(bromomethyl)pyrrolidin-2-one
Pharmaceutical intermediate
3-(4-Acetoxyphenyl)propanoic acid
pharmaceutical intermediate for API synthesis
3-bromo-7-phenylmethoxy-1,2-dihydronaphthalene
YOQXQWKWEAXKTR-UHFFFAOYSA-N
C1CC2=C(C=CC(=C2)OCC3=CC=CC=C3)C=C1Br
—