This compound is an orange azo pigment used primarily in the plastics industry. It features a complex heterocyclic structure combining benzimidazole and pyrimidinetrione moieties, contributing to its colorant properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 72102-84-2
Methylene Blue trihydrate
Bacteriological stain and dye
1-(2,5-dichloro-4-sulfophenyl)-5-pyrazolone-3-carboxylic acid
Dye intermediate
3,6-Bis(diethylamino)-9-(2-(methoxycarbonyl)phenyl)xanthylium tetrachlorozincate
Fluorescent solvent dye
Reactive Blue 81
Reactive dye for textile coloration
5-[(6-methyl-2-oxo-1,3-dihydrobenzimidazol-5-yl)diazenyl]-1,3-diazinane-2,4,6-trione
RITYHZCLJGBCAJ-UHFFFAOYSA-N
CC1=CC2=C(C=C1N=NC3C(=O)NC(=O)NC3=O)NC(=O)N2