Chloramphenicol base is a chemical compound used as a pharmaceutical intermediate in the manufacturing of the antibiotic chloramphenicol. It contains both alcohol and amine functional groups and is characterized by an aromatic ring and polar substituents.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 716-61-0
Di-p-toluoyl-D-tartaric acid monohydrate
chiral resolution reagent
(2R,3R)-2,3-Bis((4-methylbenzoyl)oxy)succinic acid hydrate
chiral resolving agent intermediate
4-Amino-5-(ethylthio)-2-methoxybenzoic acid
Pharmaceutical intermediate for amisulpride impurities
4-amino-2-methoxy-5-(methylthio)benzoic acid
Pharmaceutical intermediate for amisulpride impurities
(1R,2R)-2-amino-1-(4-nitrophenyl)propane-1,3-diol
OCYJXSUPZMNXEN-RKDXNWHRSA-N
C1=CC(=CC=C1[C@H]([C@@H](CO)N)O)[N+](=O)[O-]