Benzyl-d5 Bromide is a deuterium-labeled synthetic reagent, specifically This compound, used in chemical synthesis. Its primary significance lies in its role as a deuterated building block for introducing a benzyl group with five deuterium atoms, enabling mechanistic studies or isotopic labeling in research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 71258-22-5
Copper(II) tosylate
Catalyst for organic synthesis
Diphenyl(4-(phenylthio)phenyl)sulfonium hexafluoroantimonate
Photoinitiator for cationic polymerization
2-Phenylbenzimidazole
sunscreen agent intermediate
Didecyl dimethyl ammonium chloride
Disinfectant and biocide
BENZYL BROMIDE
Organic synthesis intermediate for benzyl protecting group
Benzyl bromide-d7
deuterated research standard
1-(bromomethyl)-2,3,4,5,6-pentadeuteriobenzene
AGEZXYOZHKGVCM-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])CBr)[2H])[2H]