(2R)-2-(phenoxymethyl)oxirane is a research compound featuring an epoxide ring and a phenyl ether moiety. It is primarily used as a laboratory reagent for chemical synthesis and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2R)-2-(phenoxymethyl)oxirane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-ethynyl-5-hexylthiophene
Research compound
4,4,5,5-TETRAMETHYL-2-(3-(METHYLTHIO)PHENYL)-1,3,2-DIOXABOROLANE
Boronic ester protecting group
4-Morpholinepropanesulfonic acid, sodium salt
biological buffer reagent
MES sodium salt
Buffering agent for biochemical research
(2S)-2-(phenoxymethyl)oxirane
Pharmaceutical intermediate
Glycidyl phenyl ether
reactive diluent for epoxy resins
(2R)-2-(phenoxymethyl)oxirane
FQYUMYWMJTYZTK-VIFPVBQESA-N
C1[C@@H](O1)COC2=CC=CC=C2
(2R)-2-(phenoxymethyl)oxirane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.