Succinylcholine chloride is a quaternary ammonium compound used as a muscle relaxant active pharmaceutical ingredient. It acts as a depolarizing neuromuscular blocker and is typically employed during surgical procedures to facilitate endotracheal intubation and provide skeletal muscle relaxation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 71-27-2
Dantrolene sodium hemiheptahydrate
muscle relaxant active pharmaceutical ingredient
Medroxyprogesterone acetate
hormonal progestin medication
Digitoxin
cardiac glycoside pharmaceutical ingredient
티오펜탈 나트륨
intravenous anaesthetic
Isopropamide Iodide
anticholinergic active pharmaceutical ingredient
trimethyl-[2-[4-oxo-4-[2-(trimethylazaniumyl)ethoxy]butanoyl]oxyethyl]azanium dichloride
YOEWQQVKRJEPAE-UHFFFAOYSA-L
C[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)C.[Cl-].[Cl-]