Succinylcholine chloride is a quaternary ammonium compound used as a muscle relaxant active pharmaceutical ingredient. It acts as a depolarizing neuromuscular blocker and is typically employed during surgical procedures to facilitate endotracheal intubation and provide skeletal muscle relaxation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Succinylcholine chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Dantrolene sodium hemiheptahydrate
muscle relaxant active pharmaceutical ingredient
Medroxyprogesterone acetate
hormonal progestin medication
Digitoxin
cardiac glycoside pharmaceutical ingredient
티오펜탈 나트륨
intravenous anaesthetic
Isopropamide Iodide
anticholinergic active pharmaceutical ingredient
Succinylcholine chloride(CAS 71-27-2)의 국제 HS 코드는 2923.90입니다.
2923.90
2923 90 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
trimethyl-[2-[4-oxo-4-[2-(trimethylazaniumyl)ethoxy]butanoyl]oxyethyl]azanium dichloride
YOEWQQVKRJEPAE-UHFFFAOYSA-L
C[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)C.[Cl-].[Cl-]
Succinylcholine chloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.