This compound is a methacrylate ester containing a dioxolane ring, primarily used as a monomer in polymer synthesis. It is commonly employed to introduce specific functional properties into polymers.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl methacrylate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-Chloro-alpha-methylstyrene
Monomer for polymer synthesis
Gamma-butyrolactone methacrylate
Monomer for polymer synthesis
Phenyl methacrylate
Monomer for polymer synthesis
Methyl 2-fluoroacrylate
Monomer for polymer synthesis
1-프로판올
solvent and disinfecting agent
1-뷰탄올
solvent and chemical intermediate
1-Pentanol
Solvent and chemical intermediate
Benzene
solvent and chemical intermediate
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate
JPFPDGRVRGETED-UHFFFAOYSA-N
CC(=C)C(=O)OCC1COC(O1)(C)C
(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl methacrylate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.