This compound is a pharmaceutical intermediate, structurally related to diphenhydramine, an antihistamine and sedative. It contains aromatic rings and alcohol and amine functional groups, indicating its role in the synthesis of active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 70708-28-0
Ethyl 2-((benzyloxy)amino)acetate
N-protected glycine derivative for peptide synthesis
4-benzylidene-2,6-di-tert-butylcyclohexa-2,5-dienone
pharmaceutical intermediate
(R)-2-(4-Hydroxy-6-methylnicotinamido)-2-(4-hydroxyphenyl)acetic acid
pharmaceutical intermediate
Cbz-D-2,4-Diaminobutyric acid
protected amino acid building block
(E)-3-(6-(1-Hydroxy-3-(pyrrolidin-1-yl)-1-(p-tolyl)propyl)pyridin-2-yl)acrylic acid
pharmaceutical active ingredient
1-(4-methylphenyl)-1-pyridin-2-yl-3-pyrrolidin-1-ylpropan-1-ol
LOJXVYLBLFSBBB-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(CCN2CCCC2)(C3=CC=CC=N3)O