2,7-Dichlorofluorene is a chlorinated aromatic compound used as an intermediate in chemical synthesis. Its structure contains two chlorine atoms on a fluorene backbone, contributing to its nonpolar, hydrophobic character.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,7-Dichlorofluorene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,4,4'-TRICHLOROBIPHENYL
polychlorinated biphenyl industrial chemical
2-(2H-Benzotriazol-2-yl)-4,6-bis(1-methyl-1-phenylethyl)phenol
UV stabilizer for plastics and coatings
항산화 물질
antioxidant and UV stabilizer
Tris(2-(2-methoxyethoxy)ethyl)amine
complexing agent for metal ions
2,7-dichloro-9H-fluorene
SDPURBHAHVFTGX-UHFFFAOYSA-N
C1C2=C(C=CC(=C2)Cl)C3=C1C=C(C=C3)Cl
2,7-Dichlorofluorene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.