D-Aspartic acid, dimethyl ester, hydrochloride is a chemical compound commonly supplied as a research reagent. It is the hydrochloride salt form of the dimethyl ester derivative of D-aspartic acid and is used primarily in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
D-Aspartic acid, dimethyl ester, hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 3-amino-6-bromopyrazine-2-carboxylate
chemical synthesis intermediate
4-(4-Fluorophenyl)-1-methyl-1,2,3,6-tetrahydropyridine
Research compound for pharmacological studies
6-Chloro-1,3-dimethyluracil
Research compound for biochemical studies
1-Methyl-2-pyrrolecarboxylic acid
research compound
H-Asp(ome)-OMe HCl
amino acid ester research compound
dimethyl (2R)-2-aminobutanedioate;hydrochloride
PNLXWGDXZOYUKB-PGMHMLKASA-N
COC(=O)C[C@H](C(=O)OC)N.Cl
D-Aspartic acid, dimethyl ester, hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.