3,4'-Dichlorodiphenyl ether is a chemical compound primarily used as a pharmaceutical intermediate in research and manufacturing. It features an ether linkage connecting two aromatic rings, each bearing a chlorine substituent, and is characterized by low polarity and a single hydrogen bond acceptor site.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,4'-Dichlorodiphenyl ether 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 3-hydroxyadamantane-1-carboxylate
Pharmaceutical intermediate
3H-Indol-3-one, 1-acetyl-6-fluoro-1,2-dihydro-
pharmaceutical intermediate
Diethyl bromomalonate
Pharmaceutical intermediate
3-aminocyclohexanol
pharmaceutical intermediate
1-chloro-3-(4-chlorophenoxy)benzene
HPRGYUWRGCTBAV-UHFFFAOYSA-N
C1=CC(=CC(=C1)Cl)OC2=CC=C(C=C2)Cl
3,4'-Dichlorodiphenyl ether 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.