This compound is a chemical compound featuring a benzoic acid core with dichloro substitution and a tert-butoxycarbonyl (Boc) protected amino group. It serves as a pharmaceutical intermediate, primarily used in the synthesis of more complex active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 669713-58-0
Anthranilic acid, n-boc-3-methyl
Pharmaceutical intermediate for synthesis
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
3-(1-(tert-butoxycarbonyl)piperidin-2-yl)propanoic acid
Pharmaceutical intermediate for API synthesis
((2R,3S,5R)-5-(6-Amino-9H-purin-9-yl)-3-hydroxytetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate
pharmaceutical intermediate for nucleoside analogs
3,5-dichloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
BGXDBARGFUXUJF-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC1=C(C=C(C=C1Cl)Cl)C(=O)O
—