Sodium 2-amino-4-chloro-5-methylbenzenesulfonate is a sulfonated aromatic amine compound used as an intermediate in dye manufacturing. It features an amine group, a chlorine substituent, and a sulfonate salt group, making it suitable for further chemical transformations in pigment and dye synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 6627-59-4
2-methoxy-5-nitroaniline hydrochloride
dye intermediate
Solvent Blue 122
solvent dye
Hexasodium 4-amino-3,6-bis[[4-[[4-chloro-6-[(3-sulphonatophenyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulphonatophenyl]azo]-5-hydroxynaphthalene-2,7-disulphonate
Reactive dye for textiles
N-(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)-3-oxo-2-[[2-(trifluoromethyl)phenyl]azo]butyramide
Pigment for plastics
sodium 2-amino-4-chloro-5-methylbenzenesulfonate
KMIGBVSYNVXBEI-UHFFFAOYSA-M
CC1=CC(=C(C=C1Cl)N)S(=O)(=O)[O-].[Na+]