3-Bromopyridine-d4 is a deuterated analog of 3-bromopyridine, in which all four hydrogen atoms on the pyridine ring are replaced by deuterium. It is primarily used as a deuterated reference compound in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry for analytical and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 66148-14-9
(E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile Hydrochloride
Research intermediate for pharmaceutical synthesis
4-(Bromomethyl)benzenesulfonyl chloride
Research reagent for sulfonyl chloride chemistry
Deuterotrifluoromethanesulfonic acid
deuterated triflic acid reference standard
5-Chloro-4-methoxypyridin-2-amine
research compound
3-BROMOPYRIDINE
building block in organic synthesis
3-bromo-2,4,5,6-tetradeuteriopyridine
NYPYPOZNGOXYSU-RHQRLBAQSA-N
[2H]C1=C(C(=C(N=C1[2H])[2H])Br)[2H]