5-Methoxy-1H-indole-3-ethylamine hydrochloride is a research compound supplied in salt form. It is structurally related to certain indole derivatives and is categorized as a Schedule I controlled substance under the US Controlled Substances Act, indicating high potential for abuse and no accepted medical use in the United States.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 66-83-1
5-METHOXYTRYPTAMINE
serotonergic receptor agonist tool compound
5-Aminovaleric acid
research compound and metabolite standard
L-norvaline
hypoglycemic and neuroprotective research compound
Triphenylsulfonium triflate
Photoacid generator for photoresists
Somatotropin (176-191)
research reagent
2-(5-methoxy-1H-indol-3-yl)ethanamine;hydrochloride
TXVAYRSEKRMEIF-UHFFFAOYSA-N
COC1=CC2=C(C=C1)NC=C2CCN.Cl