Dibenzothiophene, 1-bromo- is a brominated derivative of dibenzothiophene used as a chemical research reagent. Its structure features three aromatic rings, including a sulfur-containing heterocycle, and a single bromine substituent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Dibenzothiophene, 1-bromo- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-Mercaptotetrazole-1-methanesulfonic acid,disodium salt
Chemical research reagent
1H-indazole-6-carbonitrile
Chemical research reagent
2-Chloro-5-(trifluoromethyl)benzaldehyde
Chemical research reagent
2,4,5-Trifluoro-3-hydroxybenzoic acid
Chemical research reagent
({[Benzyl(thien-2-ylmethyl)amino]-carbonothioyl}amino)acetic acid
certified reference standard impurity
({[(2-Furylmethyl)(4-methylbenzyl)amino]-carbonothioyl}amino)acetic acid
certified reference standard
({[(2-Chlorobenzyl)(2-furylmethyl)amino]-carbonothioyl}amino)acetic acid
Certified reference standard
({[(2-Chlorobenzyl)(cyclohexyl)amino]-carbonothioyl}amino)acetic acid
Certified reference standard for impurity testing
1-bromodibenzothiophene
JESBGFNZNSEZMR-UHFFFAOYSA-N
C1=CC=C2C(=C1)C3=C(S2)C=CC=C3Br
Dibenzothiophene, 1-bromo- 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.