This compound is a protected amino acid derivative used as an impurity reference standard for the pharmaceutical intermediate ubenimex. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group and a hydroxy-phenylbutanoic acid backbone.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Fmoc-(2R,3S)-AHPA 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Boc-L-Asparagine(Xanthyl)
Protected amino acid for peptide synthesis
5-(Chloroacetyl)-1,3-dihydro-2H-indol-2-one
pharmaceutical intermediate
3-Benzyl-6-bromo-2-methoxyquinoline
pharmaceutical intermediate
Triphenylen-2-ylboronic acid
Pharmaceutical intermediate for synthesis
(2R,3R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Peptide synthesis building block
Fmoc-(2S,3R)-AHPA
Peptide synthesis building block
N-Fmoc-(2S,3S)-3-amino-2-hydroxy-4-phenyl-butyric acid
Peptide synthesis building block
(2R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-4-phenylbutanoic acid
JZSULZSNDXGGHP-XZOQPEGZSA-N
C1=CC=C(C=C1)C[C@@H]([C@H](C(=O)O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Fmoc-(2R,3S)-AHPA 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.