Boc-N-Me-Tyr(Bzl)-OH is a protected derivative of N-methyltyrosine used in peptide synthesis research. Its structure includes a tert-butoxycarbonyl (Boc) protecting group on the amine and a benzyl ether on the tyrosine side chain.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 64263-81-6
Boc-N-Me-Phe-OH
protected amino acid building block
Tetrahydropapaverine hydrochloride
research compound
Acetaminophen-d4 (major)
deuterated internal standard
N-{9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-6,9-dihydro-1H-purin-2-yl}-2-methylpropanamide
purine nucleoside for research
N-Benzylglycine ethyl ester
research compound
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-phenylmethoxyphenyl)propanoic acid
FSNRGORPOYPIJC-IBGZPJMESA-N
CC(C)(C)OC(=O)N(C)[C@@H](CC1=CC=C(C=C1)OCC2=CC=CC=C2)C(=O)O