2-Amino-1H-1,3-benzodiazole-5-carbonitrile is a research compound featuring a benzimidazole core with an amino group and a nitrile substituent. It is primarily used as a laboratory reagent in chemical and biological research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 63655-40-3
Benzyl N6-benzyloxycarbonyl-L-lysinate hydrochloride
research compound
N,N,N',N'-Tetramethyl-p-phenylenediamine dihydrochloride
Electron donor reagent for research
4,4'-Bis(dimethylamino)diphenylamine
Cytotoxicity assay reagent
Ethyl azidoacetate
research intermediate organic synthesis
2-amino-3H-benzimidazole-5-carbonitrile
PNMKRBOIMTZVLQ-UHFFFAOYSA-N
C1=CC2=C(C=C1C#N)NC(=N2)N