Gulonolactone is a chemical compound that serves as a pharmaceutical intermediate. It is structurally related to L-gulonolactone oxidase, an enzyme involved in vitamin C biosynthesis, though the compound itself functions primarily in research and manufacturing contexts.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Gulonolactone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-(2-chloroethyl)-2-methyl-6,7,8,9-tetrahydro-4h-pyrido[1,2-a]pyrimidin-4-one
Piperidopyrimidinone pharmaceutical intermediate
4-Chlorothiophen-3-amine
pharmaceutical intermediate for avatrombopag synthesis
Epicaptopril
Pharmaceutical intermediate for antihypertensives
3,5-Dibromo-2-fluoro-6-methylpyridine
pharmaceutical intermediate
Gulonolactone(CAS 6322-07-2)의 국제 HS 코드는 2932.20입니다.
2932.20
2932 20 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(3R,4S,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one
SXZYCXMUPBBULW-LECHCGJUSA-N
C([C@H]([C@H]1[C@H]([C@H](C(=O)O1)O)O)O)O
Gulonolactone 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.