This compound is an active pharmaceutical ingredient characterized as a derivative of piperazine and hydroxyphenylacetic acid. It features a complex molecular structure with multiple amide groups and an aromatic ring, reflecting its role in pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 62893-24-7
(R)-2-(4-Ethyl-2,3-dioxopiperazine-1-carboxamido)-2-phenylacetic acid
intermediate for cephalosporin and beta-lactam antibiotics
Aspirin DL-lysine
active pharmaceutical ingredient
Primaquine diphosphate
antimalarial active pharmaceutical ingredient
Sulfanilamide
sulfonamide antibacterial drug
Colfosceril palmitate
pulmonary surfactant drug
(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid
IPARGUVYMOMVNU-LLVKDONJSA-N
CCN1CCN(C(=O)C1=O)C(=O)N[C@H](C2=CC=C(C=C2)O)C(=O)O