Benzylzinc bromide is an organometallic compound used as a research reagent in organic synthesis. It is typically handled as a salt-like form and serves as a source of the benzyl group in cross-coupling reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 62673-31-8
Benzylmagnesium chloride
Grignard reagent for organic synthesis
Benzylmagnesium Bromide
Grignard reagent for organic synthesis
Tributyl(iodomethyl)stannane
organometallic reagent for organic synthesis
Magnesium chloride (2-methoxyphenyl)methanide (1/1/1)
organometallic reagent for organic synthesis
2-Iodo-6-methylpyridine
chemical research building block
Hexadecanoic-2,2-d2 acid
isotopically labeled fatty acid
1,2-dihydropyrazin-2-one
research compound
(Cys47)-HIV-1 tat Protein (47-57)
research reagent
bromozinc(1+);methanidylbenzene
WRSWIWOVJBYZAW-UHFFFAOYSA-M
[CH2-]C1=CC=CC=C1.[Zn+]Br