L-Tryptophan-d5(indole-d5) is a deuterated research reference compound of the amino acid L-tryptophan, where five hydrogen atoms on the indole ring are replaced with deuterium. It is primarily used as an internal standard or tracer in analytical chemistry and metabolic studies due to its stable isotopic labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
L-Tryptophan-d5(indole-d5) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Methoxyphenol-d3
deuterated research reference compound
4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]-2,3,5,6-tetradeuteriobenzoic acid
deuterated research reference compound
4-chlorobenzonitrile-d4
deuterated research reference compound
2-BROMOFLUOROBENZENE-D4
deuterated research reference compound
L-Tyrosine D4
stable isotope labeled research compound
1,3-DIIODOBENZENE
research compound
3-IODOANILINE
research reagent for biotin radiolabeling
3-IODOPHENOL
research reagent for coupling reactions
(2S)-2-amino-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid
QIVBCDIJIAJPQS-HLTLGYGQSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])C[C@@H](C(=O)O)N)[2H])[2H]
L-Tryptophan-d5(indole-d5) 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.