Glycerol-1,1,2,3,3-d5 is a deuterated form of glycerol, specifically labeled with five deuterium atoms at the 1, 1, 2, 3, and 3 positions. It is primarily used as a research standard in analytical chemistry and mass spectrometry for quantitation and tracing studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Glycerol-1,1,2,3,3-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3,5-Dibromo-4-nitropyridine-n-oxide
research chemical
2,5,6-Trifluoropyridine-3,4-diamine
research compound
(2r)-2-(2-chlorophenyl)oxirane
Research compound
1,2,4,5-Tetrafluoro-3-nitrobenzene
research compound
1,2,3-Propane-1,1,2,3,3-d5-triol-1,2,3-d3
deuterated research reagent
글리세롤
industrial solvent and humectant
Glycerol-1,1,2,3,3-d5(CAS 62502-71-0)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
1,1,2,3,3-pentadeuteriopropane-1,2,3-triol
PEDCQBHIVMGVHV-UXXIZXEISA-N
[2H]C([2H])(C([2H])(C([2H])([2H])O)O)O
Glycerol-1,1,2,3,3-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.