4-Chlorobenzaldehyde-2,3,5,6-d4 is a deuterated research standard used primarily in analytical chemistry and laboratory research. Its structure features a benzene ring with a chlorine substituent and an aldehyde group, with all four aromatic hydrogen atoms replaced by deuterium, making it suitable for isotope-labeled studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 62285-59-0
Glycine ethyl ester, hydrochloride
research reagent
Ethyl propiolate
Organic synthesis reagent
ETHYL IODOACETATE
Lachrymatory research reagent
Ethyl diazoacetate
laboratory reagent for organic synthesis
4-Chlorobenzaldehyde
intermediate for dyes and pharmaceuticals
4-chloro-2,3,5,6-tetradeuteriobenzaldehyde
AVPYQKSLYISFPO-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])Cl)[2H]
—