This compound is a thiophene-substituted Meldrum's acid derivative used as a synthetic intermediate in the manufacture of ticarcillin, a beta-lactam antibiotic. It contains two ester groups and an aromatic heterocycle, contributing to its role in pharmaceutical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,2-Dimethyl-5-(3-thienyl)-1,3-dioxane-4,6-dione 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 2-(3-formyl-4-hydroxyphenyl)acetate
Pharmaceutical intermediate
2-CHLORO-1-(PYRIDIN-3-YL)ETHANONE HYDROCHLORIDE
pharmaceutical intermediate
2,3,4,9-tetrahydro-1H-carbazol-3-amine
pharmaceutical intermediate
3-Hydroxy-4-nitrobenzoic acid
Pharmaceutical intermediate
2,2-dimethyl-5-thiophen-3-yl-1,3-dioxane-4,6-dione
HAGWJJFKVFSZLP-UHFFFAOYSA-N
CC1(OC(=O)C(C(=O)O1)C2=CSC=C2)C
2,2-Dimethyl-5-(3-thienyl)-1,3-dioxane-4,6-dione 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.