2-Bromo-N-phenylaniline is a chemical compound commonly used as a research reagent. It features an amine functional group, two aromatic rings, and a bromine substituent, contributing to its utility in laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-bromo-N-phenylaniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Tri-o-tolylphosphine
phosphine ligand for catalysis
2-Thiopheneboronic acid
Boronic acid building block for synthesis
Thiophene-3-boronic acid
Boronic acid reagent for synthesis
2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Boron reagent for organic synthesis
2-bromo-N-phenylaniline
WAAWAHYRHUWAFM-UHFFFAOYSA-N
C1=CC=C(C=C1)NC2=CC=CC=C2Br
2-bromo-N-phenylaniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.