4-Bromoaniline-2,3,5,6-d4 is a deuterium-labeled research compound used as an analytical standard or tracer in scientific studies. Its primary significance lies in its application as a stable isotope internal standard for mass spectrometry and other quantitative analyses.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-BROMOANILINE-2,3,5,6-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Acetylbenzonitrile
research compound
4-(Aminosulphonyl)benzeneboronic acid
Research reagent for chemical synthesis
(6-Bromopyridin-2-yl)(1-methylpiperidin-4-yl)methanone
research compound
N,N,1-Trimethylpiperidine-4-carboxamide
research compound
4-Bromoaniline
Preparation of azo dyes
4-bromo-2,3,5,6-tetradeuterioaniline
WDFQBORIUYODSI-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1N)[2H])[2H])Br)[2H]
4-BROMOANILINE-2,3,5,6-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.