This compound is a deuterated research standard, specifically the octadeuterated form of 4,4'-dihydroxybiphenyl. It is primarily used as a labeled reference compound in analytical chemistry and research applications where isotopic labeling is required.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4,4'-Dihydroxybiphenyl-D8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-HYDROXYDIPHENYL-D9
Deuterated research reference standard
1,12-dibromododecane-d24
deuterated research standard compound
Piperazine-2,2,3,3,5,5,6,6-d8 dihydrochloride
deuterated research standard compound
(3-endo)-8-Benzyl-8-azabicyclo[3.2.1]octan-3-amine tetrahydrochloride hydrate
research compound
4-fluoro-2-iodoaniline
research compound
2-Ethoxypyridine-5-boronic acid
research compound
2,2,6,6-Tetramethyl-1-nitrosopiperidine
non-carcinogenic derivative for research
4,4'-Dihydroxybiphenyl
monomer for plastic production
2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)phenol
VCCBEIPGXKNHFW-PGRXLJNUSA-N
[2H]C1=C(C(=C(C(=C1C2=C(C(=C(C(=C2[2H])[2H])O)[2H])[2H])[2H])[2H])O)[2H]
4,4'-Dihydroxybiphenyl-D8 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.