ddTTP is a modified nucleotide used as a chain-terminating inhibitor in DNA sequencing. It is a thymidine analog that lacks hydroxyl groups at both the 2' and 3' positions of the ribose ring, preventing further DNA chain elongation upon incorporation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DdTTP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
9-Methylacridine
Research compound and reference standard
4,4'-Diaminobenzophenone
research compound
5-BROMO-2-(TRIBUTYLSTANNYL)PYRIDINE
organometallic reagent for cross-coupling
N-Formyl-L-leucine
biochemical research reagent
Sodium;[hydroxy-[hydroxy-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyphosphoryl] hydrogen phosphate
research compound
[hydroxy-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate
URGJWIFLBWJRMF-JGVFFNPUSA-N
CC1=CN(C(=O)NC1=O)[C@H]2CC[C@H](O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O
DdTTP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.