4-Aminohippuric acid is a chemical compound used as a diagnostic aid for assessing renal function. It is a derivative of hippuric acid with an amino group substitution, featuring a polar, aromatic structure with carboxylic acid, amide, and amine functional groups, making it suitable for renal clearance studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 61-78-9
Dalmarelin
active pharmaceutical ingredient
Acarbose EP Impurity C
Pharmaceutical reference standard for acarbose impurity
Antibiotic 8327A
active pharmaceutical ingredient
Levothyroxine sodium pentahydrate
active pharmaceutical ingredient
2-[(4-aminobenzoyl)amino]acetic acid
HSMNQINEKMPTIC-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)NCC(=O)O)N