Dimethyl L-tartrate is a chiral chemical compound derived from tartaric acid, commonly used as a pharmaceutical intermediate in drug synthesis. Its structure features two ester and two alcohol functional groups, contributing to its role in the production of active pharmaceutical ingredients.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 608-68-4
(1S)-1-(3-Ethoxy-4-methoxy-phenyl)-2-methanesulfonyl-ethylamine
Pharmaceutical intermediate for drug synthesis
(S)-1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethanamine (S)-2-acetamido-4-methylpentanoate
pharmaceutical intermediate
(S)-(+)-3-Chloro-1,2-propanediol
pharmaceutical intermediate
3-amino-N-(tert-butyl)benzenesulfonamide
pharmaceutical intermediate
Butanedioic acid, 2,3-dihydroxy-, dimethyl ester, (2S,3S)-
chiral pharmaceutical intermediate
dimethyl (2R,3R)-2,3-dihydroxybutanedioate
PVRATXCXJDHJJN-QWWZWVQMSA-N
COC(=O)[C@@H]([C@H](C(=O)OC)O)O