2-Amino-3-nitrobenzoic acid is a crystalline research compound characterized by an aromatic ring with both amino and nitro substituents adjacent to a carboxylic acid group. It is primarily of interest in structural chemistry and crystallographic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 606-18-8
1,3-Indanedione
chemical intermediate for organic synthesis
Dihydronicotinamide-adenine dinucleotide, disodium salt
biochemical research reagent
13-Azido-2,5,8,11-tetraoxatridecane
PEG-based azide reagent
Dimethylpropanedioic acid dimethyl ester
research compound
2-amino-3-nitrobenzoic acid
JJPIVRWTAGQTPQ-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])N)C(=O)O