(4R)-4-hydroxy-L-lysine is a stereoisomer of hydroxylysine, characterized by specific chirality at both the 2 and 4 positions. As a derivative of L-lysine, it is primarily used as an intermediate in peptide synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 60594-62-9
3,3-Diphenylpropionic acid
Pharmaceutical intermediate
Methyl 4-amino-3-fluoro-5-nitro-2-(phenylamino)benzoate
pharmaceutical intermediate
Ethyl (E)-4-bromobut-2-enoate
pharmaceutical intermediate
6-chloro-2-(chloromethyl)-4-(2-fluorophenyl)-3-oxideQuinazoline
pharmaceutical intermediate
(2S,4R)-2,6-diamino-4-hydroxyhexanoic acid
ASYBZHICIMVQII-UHNVWZDZSA-N
C(CN)[C@H](C[C@@H](C(=O)O)N)O