This compound is a deuterated research standard, specifically a fully deuterated version of tert-butylamine where all hydrogen atoms in the methyl groups are replaced with deuterium. It is primarily used as a labeled reference material in analytical chemistry and mass spectrometry for quantification and tracing studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 6045-08-5
Tert-Butyl-d9-amine Hydrochloride
deuterated amine research compound
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide
research reagent
2,4-Dimethylphenylhydrazine hydrochloride
research compound
Dansyl chloride
fluorescent labeling reagent
Beta-naphthoflavone
aryl hydrocarbon receptor agonist
Tert-Butylamine borane
Borane reducing agent complex
Tert-Butylamine
Chemical intermediate for rubber accelerators and insecticides
1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-amine
YBRBMKDOPFTVDT-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])N
—